Difference between revisions of "PWY-7424"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * common-name: ** delphinidin 3,5-di-o-β-d-glucoside * smiles: ** c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == |
* common-name: | * common-name: | ||
− | ** | + | ** delphinidin 3,5-di-o-β-d-glucoside |
* smiles: | * smiles: | ||
− | ** | + | ** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xctgxgvgjyacei-lcenjuansa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 626.524 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8228]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=delphinidin 3,5-di-o-β-d-glucoside}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=626.524}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-7139
- common-name:
- delphinidin 3,5-di-o-β-d-glucoside
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
- inchi-key:
- xctgxgvgjyacei-lcenjuansa-n
- molecular-weight:
- 626.524