Difference between revisions of "PWY-7424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * common-name: ** delphinidin 3,5-di-o-β-d-glucoside * smiles: ** c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** delphinidin 3,5-di-o-β-d-glucoside
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
 
* inchi-key:
 
* inchi-key:
** cipfcgzlfxvxbg-cnwjwelysa-f
+
** xctgxgvgjyacei-lcenjuansa-n
 
* molecular-weight:
 
* molecular-weight:
** 492.013
+
** 626.524
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7184]]
 
* [[RXN-8730]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.127-RXN]]
+
* [[RXN-8228]]
* [[2.7.1.139-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
{{#set: common-name=delphinidin 3,5-di-o-β-d-glucoside}}
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
+
{{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}}
{{#set: molecular-weight=492.013}}
+
{{#set: molecular-weight=626.524}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-7139

  • common-name:
    • delphinidin 3,5-di-o-β-d-glucoside
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
  • inchi-key:
    • xctgxgvgjyacei-lcenjuansa-n
  • molecular-weight:
    • 626.524

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality