Difference between revisions of "PWY-7424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * common-name: ** delphinidin 3,5-di-o-β-d-glucoside * smiles: ** c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] == * common-name: ** d-glucurono-6,3-lactone * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCURONOLACTONE D-GLUCURONOLACTONE] ==
 
* common-name:
 
* common-name:
** delphinidin 3,5-di-o-β-d-glucoside
+
** d-glucurono-6,3-lactone
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
+
** c1(=o)(c(o)c(o)[ch](c(o)c=o)o1)
 
* inchi-key:
 
* inchi-key:
** xctgxgvgjyacei-lcenjuansa-n
+
** uyuxsradsppkrz-sknvomklsa-n
 
* molecular-weight:
 
* molecular-weight:
** 626.524
+
** 176.126
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14225]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8228]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=delphinidin 3,5-di-o-β-d-glucoside}}
+
{{#set: common-name=d-glucurono-6,3-lactone}}
{{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}}
+
{{#set: inchi-key=inchikey=uyuxsradsppkrz-sknvomklsa-n}}
{{#set: molecular-weight=626.524}}
+
{{#set: molecular-weight=176.126}}

Revision as of 09:22, 27 August 2019

Metabolite D-GLUCURONOLACTONE

  • common-name:
    • d-glucurono-6,3-lactone
  • smiles:
    • c1(=o)(c(o)c(o)[ch](c(o)c=o)o1)
  • inchi-key:
    • uyuxsradsppkrz-sknvomklsa-n
  • molecular-weight:
    • 176.126

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality