Difference between revisions of "PWY-7424"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c...")
 
(Created page with "Category:pathway == Pathway PWY-7424 == * taxonomic-range: ** tax-2759 * common-name: ** sterol:steryl ester interconversion (yeast) == Reaction(s) found == * [[RXN-15133]...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
+
== Pathway PWY-7424 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** sterol:steryl ester interconversion (yeast)
* smiles:
+
== Reaction(s) found ==
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
* [[RXN-15133]]
* inchi-key:
+
* [[RXN-15135]]
** cipfcgzlfxvxbg-cnwjwelysa-f
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-15132 RXN-15132]
** 492.013
+
* [NoneRXN-15134 RXN-15134]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2759}}
* [[RXN-7184]]
+
{{#set: common-name=sterol:steryl ester interconversion (yeast)}}
* [[RXN-8730]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.5}}
* [[2.7.1.127-RXN]]
+
{{#set: nb total reaction=4}}
* [[2.7.1.139-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
 
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
 
{{#set: molecular-weight=492.013}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-7424

  • taxonomic-range:
    • tax-2759
  • common-name:
    • sterol:steryl ester interconversion (yeast)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-15132 RXN-15132]
  • [NoneRXN-15134 RXN-15134]