Difference between revisions of "PWY-7433"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * common-name: ** coumarinate * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-]...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-D2-ENOYL-COA CIS-D2-ENOYL-COA] == * common-name: ** a cis-2-enoyl-coa == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-D2-ENOYL-COA CIS-D2-ENOYL-COA] ==
 
* common-name:
 
* common-name:
** coumarinate
+
** a cis-2-enoyl-coa
* smiles:
 
** c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
 
* inchi-key:
 
** pmowtihvnwzyfi-waywqwqtsa-m
 
* molecular-weight:
 
** 163.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17475]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8036]]
+
* [[RXN-17475]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coumarinate}}
+
{{#set: common-name=a cis-2-enoyl-coa}}
{{#set: inchi-key=inchikey=pmowtihvnwzyfi-waywqwqtsa-m}}
 
{{#set: molecular-weight=163.152}}
 

Revision as of 14:18, 26 August 2019

Metabolite CIS-D2-ENOYL-COA

  • common-name:
    • a cis-2-enoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality