Difference between revisions of "PWY-7434"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-ETCETERA-L-ASPARAGINE ACETYL-ETCETERA-L-ASPARAGINE] == * common-name: ** n4-(β-n-ac...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxyadenylated-ThiS-Proteins Thiocarboxyadenylated-ThiS-Proteins] == * common-name: ** a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-ETCETERA-L-ASPARAGINE ACETYL-ETCETERA-L-ASPARAGINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxyadenylated-ThiS-Proteins Thiocarboxyadenylated-ThiS-Proteins] ==
 
* common-name:
 
* common-name:
** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
+
** a thiocarboxy-[this-protein]
* smiles:
 
** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
 
* inchi-key:
 
** yttrpbwemmpysw-hrrfrdkfsa-n
 
* molecular-weight:
 
** 335.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.5.1.26-RXN]]
+
* [[THIAZOLSYN2-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine}}
+
{{#set: common-name=a thiocarboxy-[this-protein]}}
{{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}}
 
{{#set: molecular-weight=335.313}}
 

Revision as of 09:22, 27 August 2019

Metabolite Thiocarboxyadenylated-ThiS-Proteins

  • common-name:
    • a thiocarboxy-[this-protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a thiocarboxy-[this-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.