Difference between revisions of "PWY-7437"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: *...")
 
(Created page with "Category:pathway == Pathway PWY-7437 == * taxonomic-range: ** tax-2759 * common-name: ** protein o-[n-acetyl]-glucosylation == Reaction(s) found == * RXN-15205 == Reac...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] ==
+
== Pathway PWY-7437 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** p-nitrophenyl-α-d-galactopyranoside
+
** protein o-[n-acetyl]-glucosylation
* smiles:
+
== Reaction(s) found ==
** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
+
* [[RXN-15205]]
* inchi-key:
+
== Reaction(s) not found ==
** ifbhrqdfsncloz-iirvcbmxsa-n
+
* [NoneRXN-15215 RXN-15215]
* molecular-weight:
+
{{#set: taxonomic-range=tax-2759}}
** 301.252
+
{{#set: common-name=protein o-[n-acetyl]-glucosylation}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-17830]]
+
{{#set: completion rate=0.5}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=2}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}}
 
{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
 
{{#set: molecular-weight=301.252}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7437

  • taxonomic-range:
    • tax-2759
  • common-name:
    • protein o-[n-acetyl]-glucosylation

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-15215 RXN-15215]

Property "Common-name" (as page type) with input value "protein o-[n-acetyl]-glucosylation" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.