Difference between revisions of "PWY-7440"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O] ==
+== Pathway PWY-7440 ==
+* taxonomic-range:
+** tax-2037
 * common-name:
-** prostaglandin d2
+** dtdp-&beta;-l-4-epi-vancosamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** bhmbvrspmrccgg-outuxvnysa-m
+* [NoneRXN-15225 RXN-15225]
-* molecular-weight:
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-** 351.462
+* [NoneRXN-12404 RXN-12404]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-15227 RXN-15227]
-* [[1.1.1.188-RXN]]
+* [NoneRXN-15226 RXN-15226]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-12943 RXN-12943]
-* [[1.1.1.188-RXN]]
+* [NoneRXN-15233 RXN-15233]
-* [[PROSTAGLANDIN-D-SYNTHASE-RXN]]
+{{#set: taxonomic-range=tax-2037}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=dtdp-&beta;-l-4-epi-vancosamine biosynthesis}}
-{{#set: common-name=prostaglandin d2}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=bhmbvrspmrccgg-outuxvnysa-m}}
+{{#set: completion rate=0.12}}
-{{#set: molecular-weight=351.462}}
+{{#set: nb total reaction=8}}