Difference between revisions of "PWY-7440"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O] == * common-name: ** pro...") |
|||
| Line 1: | Line 1: | ||
| − | + | [[Category:metabolite]] | |
| − | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O] == | |
| − | + | * common-name: | |
| − | + | ** prostaglandin d2 | |
| − | + | * smiles: | |
| − | + | ** cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1) | |
| − | + | * inchi-key: | |
| − | + | ** bhmbvrspmrccgg-outuxvnysa-m | |
| − | }} | + | * molecular-weight: |
| + | ** 351.462 | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[1.1.1.188-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[1.1.1.188-RXN]] | ||
| + | * [[PROSTAGLANDIN-D-SYNTHASE-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=prostaglandin d2}} | ||
| + | {{#set: inchi-key=inchikey=bhmbvrspmrccgg-outuxvnysa-m}} | ||
| + | {{#set: molecular-weight=351.462}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O
- common-name:
- prostaglandin d2
- smiles:
- cccccc(o)c=cc1(c(=o)cc(o)c(cc=ccccc(=o)[o-])1)
- inchi-key:
- bhmbvrspmrccgg-outuxvnysa-m
- molecular-weight:
- 351.462
