Difference between revisions of "PWY-7445"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4822 CPD-4822] ==
+== Pathway PWY-7445 ==
+* taxonomic-range:
+** tax-3398
 * common-name:
-** kanamycin b
+** luteolin triglucuronide degradation
-* smiles:
+== Reaction(s) found ==
-** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
+* [[RXN-15288]]
-* inchi-key:
+== Reaction(s) not found ==
-** skklouvuunmcje-fqsmhnglsa-s
+* [NoneRXN-15289 RXN-15289]
-* molecular-weight:
+* [NoneRXN-15290 RXN-15290]
-** 488.557
+* [NoneRXN-15291 RXN-15291]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-3398}}
-* [[RXN-14553]]
+{{#set: common-name=luteolin triglucuronide degradation}}
-* [[RXN-15287]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=kanamycin b}}
-{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
-{{#set: molecular-weight=488.557}}