Difference between revisions of "PWY-7455"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * common-name: ** (2e,7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
 
* common-name:
 
* common-name:
** β-d-cellobiose
+
** (2e,7z)-hexadecenoyl-coa
 
* smiles:
 
* smiles:
** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
+
** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** gubgytabksrvrq-qrzgkkjrsa-n
+
** yqarrkbgbkpbcx-dvzfgldusa-j
 
* molecular-weight:
 
* molecular-weight:
** 342.299
+
** 997.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10773]]
+
* [[RXN-17780]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.91-RXN]]
+
* [[RXN-17779]]
* [[RXN-12305]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-cellobiose}}
+
{{#set: common-name=(2e,7z)-hexadecenoyl-coa}}
{{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}}
+
{{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}}
{{#set: molecular-weight=342.299}}
+
{{#set: molecular-weight=997.883}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-19170

  • common-name:
    • (2e,7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • yqarrkbgbkpbcx-dvzfgldusa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality