Difference between revisions of "PWY-7466"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] ==
+== Pathway PWY-7466 ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** demethylmenaquinol-8
+** acetone degradation iii (to propane-1,2-diol)
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
+* [[RXN-8630]]
-* inchi-key:
+== Reaction(s) not found ==
-** fgypgicsxjekcg-aendiincsa-n
+* [NoneACETOACETATE-DECARBOXYLASE-RXN ACETOACETATE-DECARBOXYLASE-RXN]
-* molecular-weight:
+* [NoneISOPROPANOL-DEHYDROGENASE-NADP+-RXN ISOPROPANOL-DEHYDROGENASE-NADP+-RXN]
-** 705.118
+* [NoneRXN-8632 RXN-8632]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-40674}}
-* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
+{{#set: common-name=acetone degradation iii (to propane-1,2-diol)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=demethylmenaquinol-8}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}}
-{{#set: molecular-weight=705.118}}