Difference between revisions of "PWY-7466"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12115 CPD-12115] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-FALD 2-Me-Branched-234-Sat-FALD] ==
 * common-name:
-** demethylmenaquinol-8
+** a 2-methyl branched 2,3,4-saturated fatty aldehyde
-* smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
-* inchi-key:
-** fgypgicsxjekcg-aendiincsa-n
-* molecular-weight:
-** 705.118
 == Reaction(s) known to consume the compound ==
-* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
+* [[RXN66-472]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=demethylmenaquinol-8}}
+{{#set: common-name=a 2-methyl branched 2,3,4-saturated fatty aldehyde}}
-{{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}}
-{{#set: molecular-weight=705.118}}