Difference between revisions of "PWY-7470"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-23-DEHYDROADIPYL-COA TRANS-23-DEHYDROADIPYL-COA] ==
+== Pathway PWY-7470 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** trans-2,3-dehydroadipyl-coa
+** phosphatidylcholine biosynthesis vii
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=cccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[2.3.1.23-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** zfxickrxpztfpb-kcqrsjhasa-i
+* [NoneRXN-15380 RXN-15380]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 888.606
+{{#set: common-name=phosphatidylcholine biosynthesis vii}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-2425]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[RXN-2425]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=trans-2,3-dehydroadipyl-coa}}
-{{#set: inchi-key=inchikey=zfxickrxpztfpb-kcqrsjhasa-i}}
-{{#set: molecular-weight=888.606}}