Difference between revisions of "PWY-7494"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] == * common-name: ** udp-α-d-sulfoquinovopyranose...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8052 CPD-8052] == * common-name: ** 1d-chiro-inositol * smiles: ** c1(c(c(c(c(c1o)o)o)o)o)o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8052 CPD-8052] ==
 
* common-name:
 
* common-name:
** udp-α-d-sulfoquinovopyranose
+
** 1d-chiro-inositol
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
+
** c1(c(c(c(c(c1o)o)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** fqancgqcbcusmi-jzmiexbbsa-k
+
** cdaismweouebre-lkpkboigsa-n
 
* molecular-weight:
 
* molecular-weight:
** 627.34
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14148]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1223]]
+
* [[RXN-14148]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-sulfoquinovopyranose}}
+
{{#set: common-name=1d-chiro-inositol}}
{{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}}
+
{{#set: inchi-key=inchikey=cdaismweouebre-lkpkboigsa-n}}
{{#set: molecular-weight=627.34}}
+
{{#set: molecular-weight=180.157}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-8052

  • common-name:
    • 1d-chiro-inositol
  • smiles:
    • c1(c(c(c(c(c1o)o)o)o)o)o
  • inchi-key:
    • cdaismweouebre-lkpkboigsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality