Difference between revisions of "PWY-7506"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] ==
+== Pathway THRDLCTCAT-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 6-cis, 3-oxo-tridecenoyl-coa
+** l-threonine degradation iii (to methylglyoxal)
-* smiles:
+== Reaction(s) found ==
-** ccccccc=cccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[THREODEHYD-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** fdxhxlpclxeysu-dxazuofzsa-j
+* [NoneAMACETOXID-RXN AMACETOXID-RXN]
-* molecular-weight:
+* [NoneTHREOSPON-RXN THREOSPON-RXN]
-** 971.802
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-threonine degradation iii (to methylglyoxal)}}
-* [[RXN-14774]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=6-cis, 3-oxo-tridecenoyl-coa}}
-{{#set: inchi-key=inchikey=fdxhxlpclxeysu-dxazuofzsa-j}}
-{{#set: molecular-weight=971.802}}