Difference between revisions of "PWY-7509"

Revision as of 20:19, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UBIQUINOL-30 UBIQUINOL-30] ==
+== Pathway PWY-7401 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** ubiquinol-6
+** crotonate fermentation (to acetate and cyclohexane carboxylate)
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(=c(oc)c(oc)=c(o)1)o)
+* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
-* inchi-key:
+* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
-** dyoscpiqeyrqeo-lphqiwjtsa-n
+* [[GLUTARYL-COA-DEHYDROG-RXN]]
-* molecular-weight:
+* [[RXN-11662]]
-** 592.901
+* [[RXN-11667]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-8032]]
-== Reaction(s) known to produce the compound ==
+== Reaction(s) not found ==
-* [[RXN3O-102]]
+* [NoneR282-RXN R282-RXN]
-== Reaction(s) of unknown directionality ==
+* [None1.1.1.259-RXN 1.1.1.259-RXN]
-{{#set: common-name=ubiquinol-6}}
+* [NoneRXN-15013 RXN-15013]
-{{#set: inchi-key=inchikey=dyoscpiqeyrqeo-lphqiwjtsa-n}}
+* [NoneHADTHAUERA-RXN HADTHAUERA-RXN]
-{{#set: molecular-weight=592.901}}
+* [NoneRXN-15008 RXN-15008]
+* [None4.2.1.100-RXN 4.2.1.100-RXN]
+* [NoneRXN-15010 RXN-15010]
+* [NoneR265-RXN R265-RXN]
+* [NoneRXN-15012 RXN-15012]
+{{#set: taxonomic-range=tax-2}}
+{{#set: common-name=crotonate fermentation (to acetate and cyclohexane carboxylate)}}
+{{#set: nb reaction found=6}}
+{{#set: completion rate=0.4}}
+{{#set: nb total reaction=15}}