Difference between revisions of "PWY-7539"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HX HX] == * smiles: ** [xh] * common-name: ** hx == Reaction(s) known to consume the compound =...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == * common-name...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HX HX] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] ==
 +
* common-name:
 +
** s-adenosyl-4-methylthio-2-oxobutanoate
 
* smiles:
 
* smiles:
** [xh]
+
** c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
* common-name:
+
* inchi-key:
** hx
+
** uokvqqmbgvmxpu-cjpdyehrsa-n
 +
* molecular-weight:
 +
** 397.405
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[DAPASYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GSHTRAN-RXN]]
+
* [[DAPASYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hx}}
+
{{#set: common-name=s-adenosyl-4-methylthio-2-oxobutanoate}}
 +
{{#set: inchi-key=inchikey=uokvqqmbgvmxpu-cjpdyehrsa-n}}
 +
{{#set: molecular-weight=397.405}}

Revision as of 14:18, 26 August 2019

Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE

  • common-name:
    • s-adenosyl-4-methylthio-2-oxobutanoate
  • smiles:
    • c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
  • inchi-key:
    • uokvqqmbgvmxpu-cjpdyehrsa-n
  • molecular-weight:
    • 397.405

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality