Difference between revisions of "PWY-7539"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] == * common-name...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrohemoglobins Ferrohemoglobins] == * common-name: ** a ferrohemoglobin == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrohemoglobins Ferrohemoglobins] ==
 
* common-name:
 
* common-name:
** s-adenosyl-4-methylthio-2-oxobutanoate
+
** a ferrohemoglobin
* smiles:
 
** c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
 
* inchi-key:
 
** uokvqqmbgvmxpu-cjpdyehrsa-n
 
* molecular-weight:
 
** 397.405
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DAPASYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAPASYN-RXN]]
+
* [[RXN-11195]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-adenosyl-4-methylthio-2-oxobutanoate}}
+
{{#set: common-name=a ferrohemoglobin}}
{{#set: inchi-key=inchikey=uokvqqmbgvmxpu-cjpdyehrsa-n}}
 
{{#set: molecular-weight=397.405}}
 

Revision as of 09:22, 27 August 2019

Metabolite Ferrohemoglobins

  • common-name:
    • a ferrohemoglobin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality