Difference between revisions of "PWY-7546"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNOSINE CARNOSINE] ==
+== Pathway PWY-7709 ==
+* taxonomic-range:
+** tax-3398
+** tax-4751
 * common-name:
-** carnosine
+** (3r)-linalool biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(cc(=o)nc(cc1(=cnc=n1))c([o-])=o)[n+]
+* [[GPPSYN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** cqovpnpjlqnmdc-zetcqymhsa-n
+* [None4.2.3.26-RXN 4.2.3.26-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-3398|tax-4751}}
-** 226.235
+{{#set: common-name=(3r)-linalool biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[CARNOSINE-N-METHYLTRANSFERASE-RXN]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=carnosine}}
-{{#set: inchi-key=inchikey=cqovpnpjlqnmdc-zetcqymhsa-n}}
-{{#set: molecular-weight=226.235}}