Difference between revisions of "PWY-7560"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phenyl-Acetates Phenyl-Acetates] == * common-name: ** a phenyl acetate == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * common-name: ** 7,8-dihydromonapterin * smiles: ** c1(nc2(n=c(n)nc(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydromonapterin |
| + | * smiles: | ||
| + | ** c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2)) | ||
| + | * inchi-key: | ||
| + | ** yqifamynggotfb-njgyiypdsa-n | ||
| + | * molecular-weight: | ||
| + | ** 255.233 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10857]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydromonapterin}} |
| + | {{#set: inchi-key=inchikey=yqifamynggotfb-njgyiypdsa-n}} | ||
| + | {{#set: molecular-weight=255.233}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-11770
- common-name:
- 7,8-dihydromonapterin
- smiles:
- c1(nc2(n=c(n)nc(=o)c(n=c1c(o)c(o)co)=2))
- inchi-key:
- yqifamynggotfb-njgyiypdsa-n
- molecular-weight:
- 255.233
