Difference between revisions of "PWY-7562"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3725 CPD-3725] ==
+== Pathway PWY-7562 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** uridine 2'3'-cyclic monophosphate
+** 3,6-anhydro-&alpha;-l-galactopyranose degradation
-* smiles:
+== Reaction(s) found ==
-** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
+* [[KDPGALDOL-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** hwdmhjdymfrxox-xvfcmesisa-m
+* [NoneRXN-15999 RXN-15999]
-* molecular-weight:
+* [NoneRXN-15893 RXN-15893]
-** 305.16
+* [NoneDEOXYGLUCONOKIN-RXN DEOXYGLUCONOKIN-RXN]
-== Reaction(s) known to consume the compound ==
+* [None1.1.1.127-RXN 1.1.1.127-RXN]
-* [[RXN-12060]]
+* [NoneRXN-16964 RXN-16964]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-15892 RXN-15892]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2}}
-{{#set: common-name=uridine 2'3'-cyclic monophosphate}}
+{{#set: common-name=3,6-anhydro-&alpha;-l-galactopyranose degradation}}
-{{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}}
+{{#set: nb reaction found=1}}
-{{#set: molecular-weight=305.16}}
+{{#set: completion rate=0.14}}
+{{#set: nb total reaction=7}}