Difference between revisions of "PWY-7562"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3725 CPD-3725] ==
+== Pathway GLUCARDEG-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** uridine 2'3'-cyclic monophosphate
+** d-glucarate degradation i
-* smiles:
+== Reaction(s) found ==
-** c1(=cn(c(=o)nc(=o)1)c3(oc(co)c2(op(=o)([o-])oc23)))
+* [[TSA-REDUCT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** hwdmhjdymfrxox-xvfcmesisa-m
+* [NoneGLUCARDEHYDRA-RXN GLUCARDEHYDRA-RXN]
-* molecular-weight:
+* [NoneKDGALDOL-RXN KDGALDOL-RXN]
-** 305.16
+* [NoneGKI-RXN GKI-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-12060]]
+{{#set: common-name=d-glucarate degradation i}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=uridine 2'3'-cyclic monophosphate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=hwdmhjdymfrxox-xvfcmesisa-m}}
-{{#set: molecular-weight=305.16}}