Difference between revisions of "PWY-7578"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9098 CPD-9098] ==
+== Pathway PWY-7578 ==
+* taxonomic-range:
+** tax-1117
 * common-name:
-** geranylgeranyl bacteriopheophytin
+** phycoviolobilin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
+* [[RXN-17523]]
-* inchi-key:
+== Reaction(s) not found ==
-** ijmymfmuuouget-riziqltbsa-n
+* [NoneRXN-15988 RXN-15988]
-* molecular-weight:
+* [NoneRXN-15986 RXN-15986]
-** 882.173
+* [None1.3.7.5-RXN 1.3.7.5-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-1117}}
-* [[RXN-17427]]
+{{#set: common-name=phycoviolobilin biosynthesis}}
-* [[RXN-8794]]
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=geranylgeranyl bacteriopheophytin}}
-{{#set: inchi-key=inchikey=ijmymfmuuouget-riziqltbsa-n}}
-{{#set: molecular-weight=882.173}}