Difference between revisions of "PWY-7578"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9098 CPD-9098] == * common-name: ** geranylgeranyl bacteriopheophytin * smiles: ** ccc1(c(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-arginyl-3-sulfino-L-alaninyl-Peptides L-arginyl-3-sulfino-L-alaninyl-Peptides] == * common-na...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9098 CPD-9098] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-arginyl-3-sulfino-L-alaninyl-Peptides L-arginyl-3-sulfino-L-alaninyl-Peptides] ==
 
* common-name:
 
* common-name:
** geranylgeranyl bacteriopheophytin
+
** an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein]
* smiles:
 
** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
 
* inchi-key:
 
** ijmymfmuuouget-riziqltbsa-n
 
* molecular-weight:
 
** 882.173
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17427]]
 
* [[RXN-8794]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17890]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein]}}
{{#set: inchi-key=inchikey=ijmymfmuuouget-riziqltbsa-n}}
 
{{#set: molecular-weight=882.173}}
 

Revision as of 14:18, 26 August 2019

Metabolite L-arginyl-3-sulfino-L-alaninyl-Peptides

  • common-name:
    • an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal l-arginiyl-3-sulfino-l-alanyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.