Difference between revisions of "PWY-7580"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-61 CPD-61] == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o...")
(Created page with "Category:pathway == Pathway PWY-7580 == * taxonomic-range: ** tax-35237 ** tax-1117 * common-name: ** phycoerythrobilin biosynthesis ii == Reaction(s) found == * RXN-175...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-61 CPD-61] ==
+
== Pathway PWY-7580 ==
 +
* taxonomic-range:
 +
** tax-35237
 +
** tax-1117
 
* common-name:
 
* common-name:
** (2r,3s)-2,3-dimethylmalate
+
** phycoerythrobilin biosynthesis ii
* smiles:
+
== Reaction(s) found ==
** cc(c(=o)[o-])c(c)(o)c(=o)[o-]
+
* [[RXN-17523]]
* inchi-key:
+
== Reaction(s) not found ==
** wtiiulqjlzehgz-cvyqjglwsa-l
+
* [NoneRXN-15985 RXN-15985]
* molecular-weight:
+
* [NoneRXN-9292 RXN-9292]
** 160.126
+
{{#set: taxonomic-range=tax-1117|tax-35237}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=phycoerythrobilin biosynthesis ii}}
* [[23-DIMETHYLMALATE-LYASE-RXN]]
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.33}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=(2r,3s)-2,3-dimethylmalate}}
 
{{#set: inchi-key=inchikey=wtiiulqjlzehgz-cvyqjglwsa-l}}
 
{{#set: molecular-weight=160.126}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7580

  • taxonomic-range:
    • tax-35237
    • tax-1117
  • common-name:
    • phycoerythrobilin biosynthesis ii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-15985 RXN-15985]
  • [NoneRXN-9292 RXN-9292]