Difference between revisions of "PWY-7583"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inc...") |
(Created page with "Category:pathway == Pathway PWY-7583 == * taxonomic-range: ** tax-2 * common-name: ** arachidonate biosynthesis ii (bacteria) == Reaction(s) found == * RXN-16016 == Re...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:pathway]] |
| − | == | + | == Pathway PWY-7583 == |
| + | * taxonomic-range: | ||
| + | ** tax-2 | ||
* common-name: | * common-name: | ||
| − | ** | + | ** arachidonate biosynthesis ii (bacteria) |
| − | + | == Reaction(s) found == | |
| − | + | * [[RXN-16016]] | |
| − | + | == Reaction(s) not found == | |
| − | + | All reactions of this pathways are in present | |
| − | + | {{#set: taxonomic-range=tax-2}} | |
| − | + | {{#set: common-name=arachidonate biosynthesis ii (bacteria)}} | |
| − | == Reaction(s) | + | {{#set: nb reaction found=1}} |
| − | * [[ | + | {{#set: completion rate=1.0}} |
| − | + | {{#set: nb total reaction=1}} | |
| − | |||
| − | == Reaction(s) | ||
| − | |||
| − | |||
| − | {{#set: common-name= | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 10:57, 18 March 2021
Pathway PWY-7583
- taxonomic-range:
- tax-2
- common-name:
- arachidonate biosynthesis ii (bacteria)
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present
