Difference between revisions of "PWY-7583"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LC-alcohol-LC-acyl-ester LC-alcohol-LC-acyl-ester] == * common-name: ** a long-chain alcohol--l...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LC-alcohol-LC-acyl-ester LC-alcohol-LC-acyl-ester] == |
* common-name: | * common-name: | ||
| − | ** | + | ** a long-chain alcohol--long-chain acyl wax ester |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.3.1.75-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a long-chain alcohol--long-chain acyl wax ester}} |
| − | |||
| − | |||
Revision as of 09:22, 27 August 2019
Contents
Metabolite LC-alcohol-LC-acyl-ester
- common-name:
- a long-chain alcohol--long-chain acyl wax ester
