Difference between revisions of "PWY-7583"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil16-in-tRNAs Uracil16-in-tRNAs] == * common-name: ** a uracil16 in trna == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dopamine |
| + | * smiles: | ||
| + | ** c(cc1(c=c(c(=cc=1)o)o))[n+] | ||
| + | * inchi-key: | ||
| + | ** vyfyytllbukuhu-uhfffaoysa-o | ||
| + | * molecular-weight: | ||
| + | ** 154.188 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
| + | * [[RXN6666-4]] | ||
| + | * [[RXN6666-9]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-221]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dopamine}} |
| + | {{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}} | ||
| + | {{#set: molecular-weight=154.188}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite DOPAMINE
- common-name:
- dopamine
- smiles:
- c(cc1(c=c(c(=cc=1)o)o))[n+]
- inchi-key:
- vyfyytllbukuhu-uhfffaoysa-o
- molecular-weight:
- 154.188
