Difference between revisions of "PWY-7585"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc...")
(Created page with "Category:pathway == Pathway PWY-7585 == * taxonomic-range: ** tax-2 * common-name: ** docosahexaenoate biosynthesis ii (bacteria) == Reaction(s) found == * RXN-16017 =...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] ==
+
== Pathway PWY-7585 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 5-hydroxytryptophol sulfate
+
** docosahexaenoate biosynthesis ii (bacteria)
* smiles:
+
== Reaction(s) found ==
** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
+
* [[RXN-16017]]
* inchi-key:
+
== Reaction(s) not found ==
** focuajyuoxsnds-uhfffaoysa-m
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 256.253
+
{{#set: common-name=docosahexaenoate biosynthesis ii (bacteria)}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=1.0}}
* [[RXN-10782]]
+
{{#set: nb total reaction=1}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=5-hydroxytryptophol sulfate}}
 
{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
 
{{#set: molecular-weight=256.253}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-7585

  • taxonomic-range:
    • tax-2
  • common-name:
    • docosahexaenoate biosynthesis ii (bacteria)

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present