Difference between revisions of "PWY-7585"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methylated-Ribosomal-Protein-L11s Methylated-Ribosomal-Protein-L11s] == * common-name: ** a met...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-nitrophenol |
| + | * smiles: | ||
| + | ** c1(c=c([o-])c=cc=1[n+](=o)[o-]) | ||
| + | * inchi-key: | ||
| + | ** btjiuguipkrlhp-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 138.102 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] |
| + | * [[ARYLDIALKYL-PHOSPHATASE-RXN]] | ||
| + | * [[RXN-17830]] | ||
| + | * [[RXN-8743]] | ||
| + | * [[RXN-8746]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-nitrophenol}} |
| + | {{#set: inchi-key=inchikey=btjiuguipkrlhp-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=138.102}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite P-NITROPHENOL
- common-name:
- 4-nitrophenol
- smiles:
- c1(c=c([o-])c=cc=1[n+](=o)[o-])
- inchi-key:
- btjiuguipkrlhp-uhfffaoysa-m
- molecular-weight:
- 138.102
