Difference between revisions of "PWY-7585"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-NITROPHENOL P-NITROPHENOL] == * common-name: ** 4-nitrophenol * smiles: ** c1(c=c([o-])c=cc=1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxytryptophol sulfate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** focuajyuoxsnds-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.253 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-10782]] | |
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxytryptophol sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.253}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-11674
- common-name:
- 5-hydroxytryptophol sulfate
- smiles:
- c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
- inchi-key:
- focuajyuoxsnds-uhfffaoysa-m
- molecular-weight:
- 256.253
