Difference between revisions of "PWY-7585"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] ==
+== Pathway PWY-5135 ==
+* taxonomic-range:
+** tax-3481
 * common-name:
-** 5-hydroxytryptophol sulfate
+** xanthohumol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
+* [[4-COUMARATE--COA-LIGASE-RXN]]
-* inchi-key:
+* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
-** focuajyuoxsnds-uhfffaoysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-7821 RXN-7821]
-** 256.253
+* [NoneRXN-7820 RXN-7820]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-3481}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=xanthohumol biosynthesis}}
-* [[RXN-10782]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.5}}
-{{#set: common-name=5-hydroxytryptophol sulfate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
-{{#set: molecular-weight=256.253}}