Difference between revisions of "PWY-7587"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] ==
+== Pathway PWY-7587 ==
+* taxonomic-range:
+** tax-1117
 * common-name:
-** &gamma;-l-glutamyl 5-phosphate
+** oleate biosynthesis iii (cyanobacteria)
-* smiles:
+== Reaction(s) found ==
-** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o
+* [[RXN-16024]]
-* inchi-key:
+* [[RXN-16067]]
-** pjrxvijaernuip-vkhmyheasa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-16023 RXN-16023]
-** 225.094
+{{#set: taxonomic-range=tax-1117}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=oleate biosynthesis iii (cyanobacteria)}}
-* [[G5DH]]
+{{#set: nb reaction found=2}}
-* [[G5DHm]]
+{{#set: completion rate=0.67}}
-* [[GLUTSEMIALDEHYDROG-RXN]]
+{{#set: nb total reaction=3}}
-== Reaction(s) known to produce the compound ==
-* [[GLUTKIN-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=&gamma;-l-glutamyl 5-phosphate}}
-{{#set: inchi-key=inchikey=pjrxvijaernuip-vkhmyheasa-l}}
-{{#set: molecular-weight=225.094}}