Difference between revisions of "PWY-7588"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGDP DGDP] ==
+== Pathway PWY-7588 ==
+* taxonomic-range:
+** tax-201174
+** tax-1239
 * common-name:
-** dgdp
+** ursodeoxycholate biosynthesis (bacteria)
-* smiles:
+== Reaction(s) found ==
-** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+* [[RXN-16033]]
-* inchi-key:
+== Reaction(s) not found ==
-** cikgwctvfsrmju-kvqbguixsa-k
+* [NoneRXN-16034 RXN-16034]
-* molecular-weight:
+{{#set: taxonomic-range=tax-1239|tax-201174}}
-** 424.18
+{{#set: common-name=ursodeoxycholate biosynthesis (bacteria)}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[ATDGD]]
+{{#set: completion rate=0.5}}
-* [[DGDPKIN-RXN]]
+{{#set: nb total reaction=2}}
-* [[DGTPtm]]
-* [[RXN-14207]]
-* [[RXN-14218]]
-== Reaction(s) known to produce the compound ==
-* [[ATDGM]]
-* [[DGOTO]]
-* [[DGTCY]]
-* [[DGTPtm]]
-* [[DGTUP]]
-* [[GDPREDUCT-RXN]]
-* [[RXN-14217]]
-* [[RXN0-748]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=dgdp}}
-{{#set: inchi-key=inchikey=cikgwctvfsrmju-kvqbguixsa-k}}
-{{#set: molecular-weight=424.18}}