Difference between revisions of "PWY-7592"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * common-name: ** α-d-galactose * smiles: ** c(o)...")
 
(Created page with "Category:pathway == Pathway PWY-7592 == * taxonomic-range: ** tax-33208 * common-name: ** arachidonate biosynthesis iii (6-desaturase, mammals) == Reaction(s) found == * [...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] ==
+
== Pathway PWY-7592 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** α-d-galactose
+
** arachidonate biosynthesis iii (6-desaturase, mammals)
* smiles:
+
== Reaction(s) found ==
** c(o)c1(oc(o)c(o)c(o)c(o)1)
+
* [[RXN-12777]]
* inchi-key:
+
* [[RXN-12968]]
** wqzgkkkjijffok-phyprbdbsa-n
+
* [[RXN-12969]]
* molecular-weight:
+
* [[RXN-12971]]
** 180.157
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-16064 RXN-16064]
* [[ALDOSE1EPIM-RXN]]
+
{{#set: taxonomic-range=tax-33208}}
* [[GALACTOKIN-RXN]]
+
{{#set: common-name=arachidonate biosynthesis iii (6-desaturase, mammals)}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=4}}
* [[ALDOSE1EPIM-RXN]]
+
{{#set: completion rate=0.8}}
* [[GALACTOKIN-RXN]]
+
{{#set: nb total reaction=5}}
* [[RXN-11501]]
 
* [[RXN-11502]]
 
* [[RXN-12088]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=α-d-galactose}}
 
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
 
{{#set: molecular-weight=180.157}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-7592

  • taxonomic-range:
    • tax-33208
  • common-name:
    • arachidonate biosynthesis iii (6-desaturase, mammals)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16064 RXN-16064]