Difference between revisions of "PWY-7592"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * common-name: ** α-d-galactose * smiles: ** c(o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1423 CPD0-1423] == * common-name: ** 1-stearoyl-2-stearoyl-sn-glycerol 3-phosphate * smile...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1423 CPD0-1423] ==
 
* common-name:
 
* common-name:
** α-d-galactose
+
** 1-stearoyl-2-stearoyl-sn-glycerol 3-phosphate
 
* smiles:
 
* smiles:
** c(o)c1(oc(o)c(o)c(o)c(o)1)
+
** cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** wqzgkkkjijffok-phyprbdbsa-n
+
** yfwhnaweoztipi-dipnunpcsa-l
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 702.99
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALDOSE1EPIM-RXN]]
 
* [[GALACTOKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALDOSE1EPIM-RXN]]
+
* [[RXN-16076]]
* [[GALACTOKIN-RXN]]
 
* [[RXN-11501]]
 
* [[RXN-11502]]
 
* [[RXN-12088]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-galactose}}
+
{{#set: common-name=1-stearoyl-2-stearoyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
+
{{#set: inchi-key=inchikey=yfwhnaweoztipi-dipnunpcsa-l}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=702.99}}

Revision as of 14:18, 26 August 2019

Metabolite CPD0-1423

  • common-name:
    • 1-stearoyl-2-stearoyl-sn-glycerol 3-phosphate
  • smiles:
    • cccccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccccc)=o
  • inchi-key:
    • yfwhnaweoztipi-dipnunpcsa-l
  • molecular-weight:
    • 702.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality