Difference between revisions of "PWY-7595"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi...") |
(Created page with "Category:pathway == Pathway PWY-7595 == * taxonomic-range: ** tax-1117 * common-name: ** stearidonate biosynthesis (cyanobacteria) == Reaction(s) found == * RXN-16070...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-7595 == |
+ | * taxonomic-range: | ||
+ | ** tax-1117 | ||
* common-name: | * common-name: | ||
− | ** | + | ** stearidonate biosynthesis (cyanobacteria) |
− | + | == Reaction(s) found == | |
− | + | * [[RXN-16070]] | |
− | + | == Reaction(s) not found == | |
− | + | All reactions of this pathways are in present | |
− | + | {{#set: taxonomic-range=tax-1117}} | |
− | + | {{#set: common-name=stearidonate biosynthesis (cyanobacteria)}} | |
− | == Reaction(s) | + | {{#set: nb reaction found=1}} |
− | * [[ | + | {{#set: completion rate=1.0}} |
− | + | {{#set: nb total reaction=1}} | |
− | |||
− | == Reaction(s) | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 10:59, 18 March 2021
Pathway PWY-7595
- taxonomic-range:
- tax-1117
- common-name:
- stearidonate biosynthesis (cyanobacteria)
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present