Difference between revisions of "PWY-7595"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi...") |
(Created page with "Category:pathway == Pathway COA-PWY == * taxonomic-range: ** tax-2157 ** tax-2 * common-name: ** coenzyme a biosynthesis i (prokaryotic) == Reaction(s) found == * DEPHOS...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway COA-PWY == |
+ | * taxonomic-range: | ||
+ | ** tax-2157 | ||
+ | ** tax-2 | ||
* common-name: | * common-name: | ||
− | ** | + | ** coenzyme a biosynthesis i (prokaryotic) |
− | + | == Reaction(s) found == | |
− | + | * [[DEPHOSPHOCOAKIN-RXN]] | |
− | + | * [[P-PANTOCYSDECARB-RXN]] | |
− | + | * [[P-PANTOCYSLIG-RXN]] | |
− | + | * [[PANTEPADENYLYLTRAN-RXN]] | |
− | + | == Reaction(s) not found == | |
− | == Reaction(s) | + | All reactions of this pathways are in present |
− | * [[ | + | {{#set: taxonomic-range=tax-2|tax-2157}} |
− | * [[ | + | {{#set: common-name=coenzyme a biosynthesis i (prokaryotic)}} |
− | * [[ | + | {{#set: nb reaction found=4}} |
− | + | {{#set: completion rate=1.0}} | |
− | + | {{#set: nb total reaction=4}} | |
− | |||
− | * [[ | ||
− | == Reaction(s) of | ||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Revision as of 20:17, 18 December 2020
Pathway COA-PWY
- taxonomic-range:
- tax-2157
- tax-2
- common-name:
- coenzyme a biosynthesis i (prokaryotic)
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present