Difference between revisions of "PWY-7602"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * common-name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=c...")
(Created page with "Category:pathway == Pathway PWY-7602 == * taxonomic-range: ** tax-33682 ** tax-2830 * common-name: ** icosapentaenoate biosynthesis v (8-desaturase, lower eukaryotes) == R...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] ==
+
== Pathway PWY-7602 ==
 +
* taxonomic-range:
 +
** tax-33682
 +
** tax-2830
 
* common-name:
 
* common-name:
** octoketide
+
** icosapentaenoate biosynthesis v (8-desaturase, lower eukaryotes)
* smiles:
+
== Reaction(s) found ==
** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
+
* [[RXN-12994]]
* inchi-key:
+
* [[RXN-13001]]
** wfnzgunbscuxfx-uhfffaoysa-m
+
* [[RXN-13441]]
* molecular-weight:
+
* [[RXN-16101]]
** 317.274
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-12997 RXN-12997]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-8350 RXN-8350]
* [[RXN-10734]]
+
* [NoneRXN-16100 RXN-16100]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-2830|tax-33682}}
{{#set: common-name=octoketide}}
+
{{#set: common-name=icosapentaenoate biosynthesis v (8-desaturase, lower eukaryotes)}}
{{#set: inchi-key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}}
+
{{#set: nb reaction found=4}}
{{#set: molecular-weight=317.274}}
+
{{#set: completion rate=0.57}}
 +
{{#set: nb total reaction=7}}

Latest revision as of 11:00, 18 March 2021

Pathway PWY-7602

  • taxonomic-range:
    • tax-33682
    • tax-2830
  • common-name:
    • icosapentaenoate biosynthesis v (8-desaturase, lower eukaryotes)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12997 RXN-12997]
  • [NoneRXN-8350 RXN-8350]
  • [NoneRXN-16100 RXN-16100]