Difference between revisions of "PWY-7602"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * common-name: ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * common-name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == |
* common-name: | * common-name: | ||
| − | ** | + | ** octoketide |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wfnzgunbscuxfx-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 317.274 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10734]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=octoketide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=317.274}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-11555
- common-name:
- octoketide
- smiles:
- cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
- inchi-key:
- wfnzgunbscuxfx-uhfffaoysa-m
- molecular-weight:
- 317.274
