Difference between revisions of "PWY-7602"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] == * common-name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=c...")
(Created page with "Category:pathway == Pathway PWY-6129 == * taxonomic-range: ** tax-2759 * common-name: ** dolichol and dolichyl phosphate biosynthesis == Reaction(s) found == * DOLICHOL-...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11555 CPD-11555] ==
+
== Pathway PWY-6129 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** octoketide
+
** dolichol and dolichyl phosphate biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
+
* [[DOLICHOL-KINASE-RXN]]
* inchi-key:
+
* [[RXN-9969]]
** wfnzgunbscuxfx-uhfffaoysa-m
+
* [[RXN-9971]]
* molecular-weight:
+
== Reaction(s) not found ==
** 317.274
+
* [NoneRXN-9970 RXN-9970]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-2759}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=dolichol and dolichyl phosphate biosynthesis}}
* [[RXN-10734]]
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.75}}
{{#set: common-name=octoketide}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}}
 
{{#set: molecular-weight=317.274}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6129

  • taxonomic-range:
    • tax-2759
  • common-name:
    • dolichol and dolichyl phosphate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-9970 RXN-9970]