Difference between revisions of "PWY-7618"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * common-name: ** α-d-galactose * smiles: ** c(o)...")
(Created page with "Category:pathway == Pathway PWY-7618 == * taxonomic-range: ** tax-33090 * common-name: ** ricinoleate biosynthesis == Reaction(s) found == * RXN-16151 * RXN-9670 =...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] ==
+
== Pathway PWY-7618 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** α-d-galactose
+
** ricinoleate biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(o)c1(oc(o)c(o)c(o)c(o)1)
+
* [[RXN-16151]]
* inchi-key:
+
* [[RXN-9670]]
** wqzgkkkjijffok-phyprbdbsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NonePHOSPHATIDYLCHOLINE-12-MONOOXYGENASE-RXN PHOSPHATIDYLCHOLINE-12-MONOOXYGENASE-RXN]
** 180.157
+
* [NoneRXN-19426 RXN-19426]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-19425 RXN-19425]
* [[ALDOSE1EPIM-RXN]]
+
{{#set: taxonomic-range=tax-33090}}
* [[GALACTOKIN-RXN]]
+
{{#set: common-name=ricinoleate biosynthesis}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
* [[ALDOSE1EPIM-RXN]]
+
{{#set: completion rate=0.67}}
* [[GALACTOKIN-RXN]]
+
{{#set: nb total reaction=3}}
* [[RXN-11501]]
 
* [[RXN-11502]]
 
* [[RXN-12088]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=α-d-galactose}}
 
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
 
{{#set: molecular-weight=180.157}}
 

Latest revision as of 10:57, 18 March 2021

Pathway PWY-7618

  • taxonomic-range:
    • tax-33090
  • common-name:
    • ricinoleate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NonePHOSPHATIDYLCHOLINE-12-MONOOXYGENASE-RXN PHOSPHATIDYLCHOLINE-12-MONOOXYGENASE-RXN]
  • [NoneRXN-19426 RXN-19426]
  • [NoneRXN-19425 RXN-19425]