Difference between revisions of "PWY-7618"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] == * common-name: ** α-d-galactose * smiles: ** c(o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] == * common-name: ** (indol-3-yl)acetaldehyde * smiles...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-D-GALACTOSE ALPHA-D-GALACTOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] ==
 
* common-name:
 
* common-name:
** α-d-galactose
+
** (indol-3-yl)acetaldehyde
 
* smiles:
 
* smiles:
** c(o)c1(oc(o)c(o)c(o)c(o)1)
+
** [ch](=o)cc1(c2(c(nc=1)=cc=cc=2))
 
* inchi-key:
 
* inchi-key:
** wqzgkkkjijffok-phyprbdbsa-n
+
** whooumghgspmgr-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 180.157
+
** 159.187
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ALDOSE1EPIM-RXN]]
+
* [[RXN-10715]]
* [[GALACTOKIN-RXN]]
+
* [[RXN-10717]]
 +
* [[RXN-5581]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALDOSE1EPIM-RXN]]
+
* [[RXN-1401]]
* [[GALACTOKIN-RXN]]
 
* [[RXN-11501]]
 
* [[RXN-11502]]
 
* [[RXN-12088]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-galactose}}
+
{{#set: common-name=(indol-3-yl)acetaldehyde}}
{{#set: inchi-key=inchikey=wqzgkkkjijffok-phyprbdbsa-n}}
+
{{#set: inchi-key=inchikey=whooumghgspmgr-uhfffaoysa-n}}
{{#set: molecular-weight=180.157}}
+
{{#set: molecular-weight=159.187}}

Revision as of 09:22, 27 August 2019

Metabolite INDOLE_ACETALDEHYDE

  • common-name:
    • (indol-3-yl)acetaldehyde
  • smiles:
    • [ch](=o)cc1(c2(c(nc=1)=cc=cc=2))
  • inchi-key:
    • whooumghgspmgr-uhfffaoysa-n
  • molecular-weight:
    • 159.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality