Difference between revisions of "PWY-762"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z13E-15S-15-HYDROPEROXYICOS 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS] ==
+== Pathway PWY-762 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** (15s)-hpete
+** phospholipid desaturation
-* smiles:
+== Reaction(s) found ==
-** cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-]
+* [[RXN-1725]]
-* inchi-key:
+* [[RXN-1727]]
-** bfwytordsfivkp-vaeksgalsa-m
+* [[RXN-8317]]
-* molecular-weight:
+* [[RXN-8318]]
-** 335.462
+* [[RXN-8319]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-8320]]
-== Reaction(s) known to produce the compound ==
+* [[RXN-8321]]
-* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
+* [[RXN-8322]]
-== Reaction(s) of unknown directionality ==
+* [[RXN-8323]]
-{{#set: common-name=(15s)-hpete}}
+* [[RXN-8324]]
-{{#set: inchi-key=inchikey=bfwytordsfivkp-vaeksgalsa-m}}
+* [[RXN-8325]]
-{{#set: molecular-weight=335.462}}
+* [[RXN-8326]]
+* [[RXN-8327]]
+* [[RXN-8328]]
+* [[RXN-8329]]
+* [[RXN-8330]]
+* [[RXN-8331]]
+* [[RXN-8360]]
+* [[RXN-8361]]
+== Reaction(s) not found ==
+* [NoneRXN-1726 RXN-1726]
+* [NoneRXN-8316 RXN-8316]
+{{#set: taxonomic-range=tax-33090}}
+{{#set: common-name=phospholipid desaturation}}
+{{#set: nb reaction found=19}}
+{{#set: completion rate=0.9}}
+{{#set: nb total reaction=21}}