Difference between revisions of "PWY-762"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z13E-15S-15-HYDROPEROXYICOS 5Z8Z11Z13E-15S-15-HYDROPEROXYICOS] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETR-Quinones ETR-Quinones] ==
 * common-name:
-** (15s)-hpete
+** an electron-transfer quinone
-* smiles:
-** cccccc(oo)c=cc=ccc=ccc=ccccc(=o)[o-]
-* inchi-key:
-** bfwytordsfivkp-vaeksgalsa-m
-* molecular-weight:
-** 335.462
 == Reaction(s) known to consume the compound ==
+* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+* [[NQOR-RXN]]
+* [[RXN-11356]]
+* [[RXN-11357]]
+* [[RXN-12242]]
+* [[RXN-14903]]
+* [[RXN-14971]]
+* [[RXN-15745]]
+* [[RXN0-7229]]
+* [[RXN0-7230]]
 == Reaction(s) known to produce the compound ==
-* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
+* [[RXN-15816]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(15s)-hpete}}
+{{#set: common-name=an electron-transfer quinone}}
-{{#set: inchi-key=inchikey=bfwytordsfivkp-vaeksgalsa-m}}
-{{#set: molecular-weight=335.462}}