Difference between revisions of "PWY-7625"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CGMP CGMP] == * common-name: ** cyclic-gmp * smiles: ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * common-name: ** pristanate * smiles: ** cc(cccc(cccc(c)cccc(c([o-])...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** pristanate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pahgjzdqxioyth-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 297.5 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-484]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pristanate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pahgjzdqxioyth-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=297.5}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite PRISTANATE
- common-name:
- pristanate
- smiles:
- cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c
- inchi-key:
- pahgjzdqxioyth-uhfffaoysa-m
- molecular-weight:
- 297.5
