Difference between revisions of "PWY-7625"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * common-name: ** pristanate * smiles: ** cc(cccc(cccc(c)cccc(c([o-])...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-342 CPD-342] == * common-name: ** 5α-androstane-3,17-dione * smiles: ** cc12(ccc(c[ch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-342 CPD-342] ==
 
* common-name:
 
* common-name:
** pristanate
+
** 5α-androstane-3,17-dione
 
* smiles:
 
* smiles:
** cc(cccc(cccc(c)cccc(c([o-])=o)c)c)c
+
** cc12(ccc(c[ch]1cc[ch]4([ch]2ccc3([ch](ccc(=o)3)4)c))=o)
 
* inchi-key:
 
* inchi-key:
** pahgjzdqxioyth-uhfffaoysa-m
+
** rajwobjttgjroa-wznaksscsa-n
 
* molecular-weight:
 
* molecular-weight:
** 297.5
+
** 288.429
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-484]]
+
* [[RXN-12124]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pristanate}}
+
{{#set: common-name=5α-androstane-3,17-dione}}
{{#set: inchi-key=inchikey=pahgjzdqxioyth-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=rajwobjttgjroa-wznaksscsa-n}}
{{#set: molecular-weight=297.5}}
+
{{#set: molecular-weight=288.429}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-342

  • common-name:
    • 5α-androstane-3,17-dione
  • smiles:
    • cc12(ccc(c[ch]1cc[ch]4([ch]2ccc3([ch](ccc(=o)3)4)c))=o)
  • inchi-key:
    • rajwobjttgjroa-wznaksscsa-n
  • molecular-weight:
    • 288.429

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality