Difference between revisions of "PWY-7645"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18493 CPD-18493] ==
+== Pathway PWY-31 ==
+* taxonomic-range:
+** tax-3803
 * common-name:
-** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+** canavanine degradation
-* smiles:
+== Reaction(s) found ==
-** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+* [[RXN-34]]
-* inchi-key:
+== Reaction(s) not found ==
-** nneppynerzejee-vugypbmhsa-j
+* [NoneRXN-35 RXN-35]
-* molecular-weight:
+{{#set: taxonomic-range=tax-3803}}
-** 1120.05
+{{#set: common-name=canavanine degradation}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-* [[RXN-17114]]
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
-{{#set: inchi-key=inchikey=nneppynerzejee-vugypbmhsa-j}}
-{{#set: molecular-weight=1120.05}}