Difference between revisions of "PWY-7661"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cyclic-3-5-Nucleoside-Monophosphates Cyclic-3-5-Nucleoside-Monophosphates] == * common-name: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14202 CPD-14202] == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14202 CPD-14202] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-erythro-7,8-dihydrobiopterin |
| + | * smiles: | ||
| + | ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) | ||
| + | * inchi-key: | ||
| + | ** femxzdutfrtwpe-dzswipipsa-n | ||
| + | * molecular-weight: | ||
| + | ** 239.233 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7908]] | ||
| + | * [[SEPIAPTERIN-REDUCTASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-erythro-7,8-dihydrobiopterin}} |
| + | {{#set: inchi-key=inchikey=femxzdutfrtwpe-dzswipipsa-n}} | ||
| + | {{#set: molecular-weight=239.233}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-14202
- common-name:
- l-erythro-7,8-dihydrobiopterin
- smiles:
- cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
- inchi-key:
- femxzdutfrtwpe-dzswipipsa-n
- molecular-weight:
- 239.233
