Difference between revisions of "PWY-7663"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * common-name: ** creatine * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * inchi...") |
(Created page with "Category:pathway == Pathway PWY-7663 == * taxonomic-range: ** tax-2 * common-name: ** gondoate biosynthesis (anaerobic) == Reaction(s) found == * RXN-16629 * RXN-166...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-7663 == |
+ | * taxonomic-range: | ||
+ | ** tax-2 | ||
* common-name: | * common-name: | ||
− | ** | + | ** gondoate biosynthesis (anaerobic) |
− | + | == Reaction(s) found == | |
− | + | * [[RXN-16629]] | |
− | + | * [[RXN-16630]] | |
− | + | * [[RXN-16631]] | |
− | + | * [[RXN-16632]] | |
− | + | == Reaction(s) not found == | |
− | == Reaction(s) | + | All reactions of this pathways are in present |
− | * [[ | + | {{#set: taxonomic-range=tax-2}} |
− | * [[ | + | {{#set: common-name=gondoate biosynthesis (anaerobic)}} |
− | * [[ | + | {{#set: nb reaction found=4}} |
− | + | {{#set: completion rate=1.0}} | |
− | + | {{#set: nb total reaction=4}} | |
− | * [[ | ||
− | |||
− | == Reaction(s) of | ||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |